About 4-[4-(2-tert-butylphenoxy)butyl]-3,5-dimethyl-1H-pyrazole
4-[4-(2-tert-butylphenoxy)butyl]-3,5-dimethyl-1H-pyrazole (PubChem CID 2304782) has the molecular formula C19H28N2O
and a molecular weight of 300.45 g/mol. Its IUPAC name is 4-[4-(2-tert-butylphenoxy)butyl]-3,5-dimethyl-1H-pyrazole.
Molecular Properties
| Compound Name | 4-[4-(2-tert-butylphenoxy)butyl]-3,5-dimethyl-1H-pyrazole |
| PubChem CID | 2304782 |
| Molecular Formula | C19H28N2O |
| Molecular Weight | 300.45 g/mol |
| Exact Mass | 300.22 |
| IUPAC Name | 4-[4-(2-tert-butylphenoxy)butyl]-3,5-dimethyl-1H-pyrazole |
| SMILES | Cc1n[nH]c(C)c1CCCCOc1ccccc1C(C)(C)C |
| InChI | InChI=1S/C19H28N2O/c1-14-16(15(2)21-20-14)10-8-9-13-22-18-12-7-6-11-17(18)19(3,4)5/h6-7,11-12H,8-10,13H2,1-5H3,(H,20,21) |
| InChIKey | SSZUZIXWMLXEHR-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.45 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-[4-(2-tert-butylphenoxy)butyl]-3,5-dimethyl-1H-pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(2-tert-butylphenoxy)butyl]-3,5-dimethyl-1H-pyrazole?
The IUPAC name of 4-[4-(2-tert-butylphenoxy)butyl]-3,5-dimethyl-1H-pyrazole (CID 2304782) is 4-[4-(2-tert-butylphenoxy)butyl]-3,5-dimethyl-1H-pyrazole.
What is the SMILES notation for 4-[4-(2-tert-butylphenoxy)butyl]-3,5-dimethyl-1H-pyrazole?
The canonical SMILES for 4-[4-(2-tert-butylphenoxy)butyl]-3,5-dimethyl-1H-pyrazole is Cc1n[nH]c(C)c1CCCCOc1ccccc1C(C)(C)C.
What is the InChIKey of 4-[4-(2-tert-butylphenoxy)butyl]-3,5-dimethyl-1H-pyrazole?
The InChIKey is SSZUZIXWMLXEHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H28N2O/c1-14-16(15(2)21-20-14)10-8-9-13-22-18-12-7-6-11-17(18)19(3,4)5/h6-7,11-12H,8-10,13H2,1-5H3,(H,20,21).
What are the key properties of 4-[4-(2-tert-butylphenoxy)butyl]-3,5-dimethyl-1H-pyrazole?
4-[4-(2-tert-butylphenoxy)butyl]-3,5-dimethyl-1H-pyrazole has a molecular weight of 300.45 g/mol, XLogP of 4.73, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(2-tert-butylphenoxy)butyl]-3,5-dimethyl-1H-pyrazole is sourced from PubChem (CID 2304782), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).