C19H28N2O — CID 2304782
4-[4-(2-tert-butylphenoxy)butyl]-3,5-dimethyl-1H-pyrazole (PubChem CID 2304782) has the molecular formula C19H28N2O and a molecular weight of 300.45 g/mol. Its IUPAC name is 4-[4-(2-tert-butylphenoxy)butyl]-3,5-dimethyl-1H-pyrazole.
| Compound Name | 4-[4-(2-tert-butylphenoxy)butyl]-3,5-dimethyl-1H-pyrazole |
|---|---|
| PubChem CID | 2304782 |
| Molecular Formula | C19H28N2O |
| Molecular Weight | 300.45 g/mol |
| Exact Mass | 300.22 |
| IUPAC Name | 4-[4-(2-tert-butylphenoxy)butyl]-3,5-dimethyl-1H-pyrazole |
| SMILES | Cc1n[nH]c(C)c1CCCCOc1ccccc1C(C)(C)C |
| InChI | InChI=1S/C19H28N2O/c1-14-16(15(2)21-20-14)10-8-9-13-22-18-12-7-6-11-17(18)19(3,4)5/h6-7,11-12H,8-10,13H2,1-5H3,(H,20,21) |
| InChIKey | SSZUZIXWMLXEHR-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.45 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|