About 3-(3,5-dimethyl-1H-pyrazol-4-yl)propanoic acid;hydrochloride
3-(3,5-dimethyl-1H-pyrazol-4-yl)propanoic acid;hydrochloride (PubChem CID 47000616) has the molecular formula C8H13ClN2O2
and a molecular weight of 204.66 g/mol. Its IUPAC name is 3-(3,5-dimethyl-1H-pyrazol-4-yl)propanoic acid;hydrochloride.
Analyze 3-(3,5-dimethyl-1H-pyrazol-4-yl)propanoic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,5-dimethyl-1H-pyrazol-4-yl)propanoic acid;hydrochloride?
The IUPAC name of 3-(3,5-dimethyl-1H-pyrazol-4-yl)propanoic acid;hydrochloride (CID 47000616) is 3-(3,5-dimethyl-1H-pyrazol-4-yl)propanoic acid;hydrochloride.
What is the SMILES notation for 3-(3,5-dimethyl-1H-pyrazol-4-yl)propanoic acid;hydrochloride?
The canonical SMILES for 3-(3,5-dimethyl-1H-pyrazol-4-yl)propanoic acid;hydrochloride is Cc1n[nH]c(C)c1CCC(=O)O.Cl.
What is the InChIKey of 3-(3,5-dimethyl-1H-pyrazol-4-yl)propanoic acid;hydrochloride?
The InChIKey is SNDJYEDBCIBMSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O2.ClH/c1-5-7(3-4-8(11)12)6(2)10-9-5;/h3-4H2,1-2H3,(H,9,10)(H,11,12);1H.
What are the key properties of 3-(3,5-dimethyl-1H-pyrazol-4-yl)propanoic acid;hydrochloride?
3-(3,5-dimethyl-1H-pyrazol-4-yl)propanoic acid;hydrochloride has a molecular weight of 204.66 g/mol, XLogP of 1.47, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,5-dimethyl-1H-pyrazol-4-yl)propanoic acid;hydrochloride is sourced from PubChem (CID 47000616), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).