C8H14N4O — CID 43644720
2-[(3,5-dimethyl-1H-pyrazol-4-yl)methylamino]acetamide (PubChem CID 43644720) has the molecular formula C8H14N4O and a molecular weight of 182.23 g/mol. Its IUPAC name is 2-[(3,5-dimethyl-1H-pyrazol-4-yl)methylamino]acetamide.
| Compound Name | 2-[(3,5-dimethyl-1H-pyrazol-4-yl)methylamino]acetamide |
|---|---|
| PubChem CID | 43644720 |
| Molecular Formula | C8H14N4O |
| Molecular Weight | 182.23 g/mol |
| Exact Mass | 182.12 |
| IUPAC Name | 2-[(3,5-dimethyl-1H-pyrazol-4-yl)methylamino]acetamide |
| SMILES | Cc1n[nH]c(C)c1CNCC(N)=O |
| InChI | InChI=1S/C8H14N4O/c1-5-7(6(2)12-11-5)3-10-4-8(9)13/h10H,3-4H2,1-2H3,(H2,9,13)(H,11,12) |
| InChIKey | QSVFQFSKVZAQGY-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.23 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |