C13H22N4O — CID 112732619
N-cyclopropyl-4-[(3,5-dimethyl-1H-pyrazol-4-yl)methylamino]butanamide (PubChem CID 112732619) has the molecular formula C13H22N4O and a molecular weight of 250.35 g/mol. Its IUPAC name is N-cyclopropyl-4-[(3,5-dimethyl-1H-pyrazol-4-yl)methylamino]butanamide.
| Compound Name | N-cyclopropyl-4-[(3,5-dimethyl-1H-pyrazol-4-yl)methylamino]butanamide |
|---|---|
| PubChem CID | 112732619 |
| Molecular Formula | C13H22N4O |
| Molecular Weight | 250.35 g/mol |
| Exact Mass | 250.18 |
| IUPAC Name | N-cyclopropyl-4-[(3,5-dimethyl-1H-pyrazol-4-yl)methylamino]butanamide |
| SMILES | Cc1n[nH]c(C)c1CNCCCC(=O)NC1CC1 |
| InChI | InChI=1S/C13H22N4O/c1-9-12(10(2)17-16-9)8-14-7-3-4-13(18)15-11-5-6-11/h11,14H,3-8H2,1-2H3,(H,15,18)(H,16,17) |
| InChIKey | NWWRGCCBQRDGIG-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.35 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|