C9H13N3O3 — CID 16645428
4-[(3,5-dimethyl-1H-pyrazol-4-yl)amino]-4-oxobutanoic acid (PubChem CID 16645428) has the molecular formula C9H13N3O3 and a molecular weight of 211.22 g/mol. Its IUPAC name is 4-[(3,5-dimethyl-1H-pyrazol-4-yl)amino]-4-oxobutanoic acid.
| Compound Name | 4-[(3,5-dimethyl-1H-pyrazol-4-yl)amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 16645428 |
| Molecular Formula | C9H13N3O3 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | 4-[(3,5-dimethyl-1H-pyrazol-4-yl)amino]-4-oxobutanoic acid |
| SMILES | Cc1n[nH]c(C)c1NC(=O)CCC(=O)O |
| InChI | InChI=1S/C9H13N3O3/c1-5-9(6(2)12-11-5)10-7(13)3-4-8(14)15/h3-4H2,1-2H3,(H,10,13)(H,11,12)(H,14,15) |
| InChIKey | DEIBDFGWJPSLEX-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |