C15H25N3O — CID 43399158
4-cyclohexyl-N-(3,5-dimethyl-1H-pyrazol-4-yl)butanamide (PubChem CID 43399158) has the molecular formula C15H25N3O and a molecular weight of 263.38 g/mol. Its IUPAC name is 4-cyclohexyl-N-(3,5-dimethyl-1H-pyrazol-4-yl)butanamide.
| Compound Name | 4-cyclohexyl-N-(3,5-dimethyl-1H-pyrazol-4-yl)butanamide |
|---|---|
| PubChem CID | 43399158 |
| Molecular Formula | C15H25N3O |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.20 |
| IUPAC Name | 4-cyclohexyl-N-(3,5-dimethyl-1H-pyrazol-4-yl)butanamide |
| SMILES | Cc1n[nH]c(C)c1NC(=O)CCCC1CCCCC1 |
| InChI | InChI=1S/C15H25N3O/c1-11-15(12(2)18-17-11)16-14(19)10-6-9-13-7-4-3-5-8-13/h13H,3-10H2,1-2H3,(H,16,19)(H,17,18) |
| InChIKey | MHNQFCJSVCIVGI-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |