C10H16BrN3O — CID 107908306
5-bromo-N-(3,5-dimethyl-1H-pyrazol-4-yl)pentanamide (PubChem CID 107908306) has the molecular formula C10H16BrN3O and a molecular weight of 274.16 g/mol. Its IUPAC name is 5-bromo-N-(3,5-dimethyl-1H-pyrazol-4-yl)pentanamide.
| Compound Name | 5-bromo-N-(3,5-dimethyl-1H-pyrazol-4-yl)pentanamide |
|---|---|
| PubChem CID | 107908306 |
| Molecular Formula | C10H16BrN3O |
| Molecular Weight | 274.16 g/mol |
| Exact Mass | 273.05 |
| IUPAC Name | 5-bromo-N-(3,5-dimethyl-1H-pyrazol-4-yl)pentanamide |
| SMILES | Cc1n[nH]c(C)c1NC(=O)CCCCBr |
| InChI | InChI=1S/C10H16BrN3O/c1-7-10(8(2)14-13-7)12-9(15)5-3-4-6-11/h3-6H2,1-2H3,(H,12,15)(H,13,14) |
| InChIKey | YWJOTDREGYAFAP-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.16 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|