C16H20N4O — CID 5054888
3-(3,5-dimethyl-1H-pyrazol-4-yl)-N'-(1-phenylethenyl)propanehydrazide (PubChem CID 5054888) has the molecular formula C16H20N4O and a molecular weight of 284.36 g/mol. Its IUPAC name is 3-(3,5-dimethyl-1H-pyrazol-4-yl)-N'-(1-phenylethenyl)propanehydrazide.
| Compound Name | 3-(3,5-dimethyl-1H-pyrazol-4-yl)-N'-(1-phenylethenyl)propanehydrazide |
|---|---|
| PubChem CID | 5054888 |
| Molecular Formula | C16H20N4O |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | 3-(3,5-dimethyl-1H-pyrazol-4-yl)-N'-(1-phenylethenyl)propanehydrazide |
| SMILES | C=C(NNC(=O)CCc1c(C)n[nH]c1C)c1ccccc1 |
| InChI | InChI=1S/C16H20N4O/c1-11(14-7-5-4-6-8-14)17-20-16(21)10-9-15-12(2)18-19-13(15)3/h4-8,17H,1,9-10H2,2-3H3,(H,18,19)(H,20,21) |
| InChIKey | OPJVGLWLRGHUQW-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|