C20H25N6O+ — CID 135850183
N-[(E)-(3,5-dimethyl-2-phenyl-1H-pyrazol-2-ium-4-yl)methylideneamino]-3-(3,5-dimethyl-1H-pyrazol-4-yl)propanamide (PubChem CID 135850183) has the molecular formula C20H25N6O+ and a molecular weight of 365.46 g/mol. Its IUPAC name is N-[(E)-(3,5-dimethyl-2-phenyl-1H-pyrazol-2-ium-4-yl)methylideneamino]-3-(3,5-dimethyl-1H-pyrazol-4-yl)propanamide.
| Compound Name | N-[(E)-(3,5-dimethyl-2-phenyl-1H-pyrazol-2-ium-4-yl)methylideneamino]-3-(3,5-dimethyl-1H-pyrazol-4-yl)propanamide |
|---|---|
| PubChem CID | 135850183 |
| Molecular Formula | C20H25N6O+ |
| Molecular Weight | 365.46 g/mol |
| Exact Mass | 365.21 |
| IUPAC Name | N-[(E)-(3,5-dimethyl-2-phenyl-1H-pyrazol-2-ium-4-yl)methylideneamino]-3-(3,5-dimethyl-1H-pyrazol-4-yl)propanamide |
| SMILES | Cc1n[nH]c(C)c1CCC(=O)N/N=C/c1c(C)[nH][n+](-c2ccccc2)c1C |
| InChI | InChI=1S/C20H24N6O/c1-13-18(14(2)23-22-13)10-11-20(27)24-21-12-19-15(3)25-26(16(19)4)17-8-6-5-7-9-17/h5-9,12H,10-11H2,1-4H3,(H2,22,23,24,27)/p+1/b21-12+ |
| InChIKey | YHFNQCBIAWFYAY-CIAFOILYSA-O |
| XLogP | 2.33 |
| TPSA | 89.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.46 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|