C23H23N6O2+ — CID 135624099
N-[(E)-(3,5-dimethyl-2-phenyl-1H-pyrazol-2-ium-4-yl)methylideneamino]-3-(2-methoxyphenyl)-1H-pyrazole-5-carboxamide (PubChem CID 135624099) has the molecular formula C23H23N6O2+ and a molecular weight of 415.48 g/mol. Its IUPAC name is N-[(E)-(3,5-dimethyl-2-phenyl-1H-pyrazol-2-ium-4-yl)methylideneamino]-3-(2-methoxyphenyl)-1H-pyrazole-5-carboxamide.
| Compound Name | N-[(E)-(3,5-dimethyl-2-phenyl-1H-pyrazol-2-ium-4-yl)methylideneamino]-3-(2-methoxyphenyl)-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 135624099 |
| Molecular Formula | C23H23N6O2+ |
| Molecular Weight | 415.48 g/mol |
| Exact Mass | 415.19 |
| IUPAC Name | N-[(E)-(3,5-dimethyl-2-phenyl-1H-pyrazol-2-ium-4-yl)methylideneamino]-3-(2-methoxyphenyl)-1H-pyrazole-5-carboxamide |
| SMILES | COc1ccccc1-c1cc(C(=O)N/N=C/c2c(C)[nH][n+](-c3ccccc3)c2C)[nH]n1 |
| InChI | InChI=1S/C23H22N6O2/c1-15-19(16(2)29(28-15)17-9-5-4-6-10-17)14-24-27-23(30)21-13-20(25-26-21)18-11-7-8-12-22(18)31-3/h4-14H,1-3H3,(H2,25,26,27,30)/p+1/b24-14+ |
| InChIKey | GBMDBIMRXIHNBF-ZVHZXABRSA-O |
| XLogP | 3.07 |
| TPSA | 99.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.48 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|