C11H11N3O3 — CID 71601258
N-hydroxy-3-(2-methoxyphenyl)-1H-pyrazole-5-carboxamide (PubChem CID 71601258) has the molecular formula C11H11N3O3 and a molecular weight of 233.23 g/mol. Its IUPAC name is N-hydroxy-3-(2-methoxyphenyl)-1H-pyrazole-5-carboxamide.
| Compound Name | N-hydroxy-3-(2-methoxyphenyl)-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 71601258 |
| Molecular Formula | C11H11N3O3 |
| Molecular Weight | 233.23 g/mol |
| Exact Mass | 233.08 |
| IUPAC Name | N-hydroxy-3-(2-methoxyphenyl)-1H-pyrazole-5-carboxamide |
| SMILES | COc1ccccc1-c1cc(C(=O)NO)[nH]n1 |
| InChI | InChI=1S/C11H11N3O3/c1-17-10-5-3-2-4-7(10)8-6-9(13-12-8)11(15)14-16/h2-6,16H,1H3,(H,12,13)(H,14,15) |
| InChIKey | PDTMRLXZUGQXOX-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 87.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.23 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|