C15H19N3O3 — CID 110000867
N-(1-hydroxy-2-methylpropan-2-yl)-3-(2-methoxyphenyl)-1H-pyrazole-5-carboxamide (PubChem CID 110000867) has the molecular formula C15H19N3O3 and a molecular weight of 289.34 g/mol. Its IUPAC name is N-(1-hydroxy-2-methylpropan-2-yl)-3-(2-methoxyphenyl)-1H-pyrazole-5-carboxamide.
| Compound Name | N-(1-hydroxy-2-methylpropan-2-yl)-3-(2-methoxyphenyl)-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 110000867 |
| Molecular Formula | C15H19N3O3 |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | N-(1-hydroxy-2-methylpropan-2-yl)-3-(2-methoxyphenyl)-1H-pyrazole-5-carboxamide |
| SMILES | COc1ccccc1-c1cc(C(=O)NC(C)(C)CO)[nH]n1 |
| InChI | InChI=1S/C15H19N3O3/c1-15(2,9-19)16-14(20)12-8-11(17-18-12)10-6-4-5-7-13(10)21-3/h4-8,19H,9H2,1-3H3,(H,16,20)(H,17,18) |
| InChIKey | VETJCCSPNONBLS-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 87.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |