C26H23N6O2+ — CID 135841703
3-(3,5-dimethyl-2-phenyl-1H-pyrazol-2-ium-4-yl)-N-[(E)-(2-hydroxynaphthalen-1-yl)methylideneamino]-1H-pyrazole-5-carboxamide (PubChem CID 135841703) has the molecular formula C26H23N6O2+ and a molecular weight of 451.51 g/mol. Its IUPAC name is 3-(3,5-dimethyl-2-phenyl-1H-pyrazol-2-ium-4-yl)-N-[(E)-(2-hydroxynaphthalen-1-yl)methylideneamino]-1H-pyrazole-5-carboxamide.
| Compound Name | 3-(3,5-dimethyl-2-phenyl-1H-pyrazol-2-ium-4-yl)-N-[(E)-(2-hydroxynaphthalen-1-yl)methylideneamino]-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 135841703 |
| Molecular Formula | C26H23N6O2+ |
| Molecular Weight | 451.51 g/mol |
| Exact Mass | 451.19 |
| IUPAC Name | 3-(3,5-dimethyl-2-phenyl-1H-pyrazol-2-ium-4-yl)-N-[(E)-(2-hydroxynaphthalen-1-yl)methylideneamino]-1H-pyrazole-5-carboxamide |
| SMILES | Cc1[nH][n+](-c2ccccc2)c(C)c1-c1cc(C(=O)N/N=C/c2c(O)ccc3ccccc23)[nH]n1 |
| InChI | InChI=1S/C26H22N6O2/c1-16-25(17(2)32(31-16)19-9-4-3-5-10-19)22-14-23(29-28-22)26(34)30-27-15-21-20-11-7-6-8-18(20)12-13-24(21)33/h3-15H,1-2H3,(H3,27,28,29,30,33,34)/p+1 |
| InChIKey | HMIHLFJWLOPRMY-UHFFFAOYSA-O |
| XLogP | 3.92 |
| TPSA | 110.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.51 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|