C9H8Cl4 — CID 164664880
1,2,3-trichloro-4-(chloromethyl)-5,6-dimethylbenzene (PubChem CID 164664880) has the molecular formula C9H8Cl4 and a molecular weight of 257.97 g/mol. Its IUPAC name is 1,2,3-trichloro-4-(chloromethyl)-5,6-dimethylbenzene.
| Compound Name | 1,2,3-trichloro-4-(chloromethyl)-5,6-dimethylbenzene |
|---|---|
| PubChem CID | 164664880 |
| Molecular Formula | C9H8Cl4 |
| Molecular Weight | 257.97 g/mol |
| Exact Mass | 255.94 |
| IUPAC Name | 1,2,3-trichloro-4-(chloromethyl)-5,6-dimethylbenzene |
| SMILES | Cc1c(C)c(CCl)c(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C9H8Cl4/c1-4-5(2)7(11)9(13)8(12)6(4)3-10/h3H2,1-2H3 |
| InChIKey | NXPYFMCJHHJLJX-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.97 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|