C14H22O2 — CID 12721344
1,3-bis(methoxymethyl)-2,4,5,6-tetramethylbenzene (PubChem CID 12721344) has the molecular formula C14H22O2 and a molecular weight of 222.33 g/mol. Its IUPAC name is 1,3-bis(methoxymethyl)-2,4,5,6-tetramethylbenzene.
| Compound Name | 1,3-bis(methoxymethyl)-2,4,5,6-tetramethylbenzene |
|---|---|
| PubChem CID | 12721344 |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | 1,3-bis(methoxymethyl)-2,4,5,6-tetramethylbenzene |
| SMILES | COCc1c(C)c(C)c(C)c(COC)c1C |
| InChI | InChI=1S/C14H22O2/c1-9-10(2)13(7-15-5)12(4)14(8-16-6)11(9)3/h7-8H2,1-6H3 |
| InChIKey | YPURWSWECWEZHZ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |