C15H18O2 — CID 90738504
1-methoxy-4-(methoxymethyl)-2,3-dimethylnaphthalene (PubChem CID 90738504) has the molecular formula C15H18O2 and a molecular weight of 230.31 g/mol. Its IUPAC name is 1-methoxy-4-(methoxymethyl)-2,3-dimethylnaphthalene.
| Compound Name | 1-methoxy-4-(methoxymethyl)-2,3-dimethylnaphthalene |
|---|---|
| PubChem CID | 90738504 |
| Molecular Formula | C15H18O2 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | 1-methoxy-4-(methoxymethyl)-2,3-dimethylnaphthalene |
| SMILES | COCc1c(C)c(C)c(OC)c2ccccc12 |
| InChI | InChI=1S/C15H18O2/c1-10-11(2)15(17-4)13-8-6-5-7-12(13)14(10)9-16-3/h5-8H,9H2,1-4H3 |
| InChIKey | LVPZNSSMKCUWSG-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |