C8H13NS — CID 130010160
4-ethyl-3,5-dimethyl-1H-pyrrole-2-thiol (PubChem CID 130010160) has the molecular formula C8H13NS and a molecular weight of 155.27 g/mol. Its IUPAC name is 4-ethyl-3,5-dimethyl-1H-pyrrole-2-thiol.
| Compound Name | 4-ethyl-3,5-dimethyl-1H-pyrrole-2-thiol |
|---|---|
| PubChem CID | 130010160 |
| Molecular Formula | C8H13NS |
| Molecular Weight | 155.27 g/mol |
| Exact Mass | 155.08 |
| IUPAC Name | 4-ethyl-3,5-dimethyl-1H-pyrrole-2-thiol |
| SMILES | CCc1c(C)[nH]c(S)c1C |
| InChI | InChI=1S/C8H13NS/c1-4-7-5(2)8(10)9-6(7)3/h9-10H,4H2,1-3H3 |
| InChIKey | FBTVXVHXXQIMNC-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.27 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|