About tert-butyl 4-ethyl-3,5-dimethyl-1H-pyrrole-2-carboxylate
tert-butyl 4-ethyl-3,5-dimethyl-1H-pyrrole-2-carboxylate (PubChem CID 2825670) has the molecular formula C13H21NO2
and a molecular weight of 223.32 g/mol. Its IUPAC name is tert-butyl 4-ethyl-3,5-dimethyl-1H-pyrrole-2-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 4-ethyl-3,5-dimethyl-1H-pyrrole-2-carboxylate |
| PubChem CID | 2825670 |
| Molecular Formula | C13H21NO2 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.16 |
| IUPAC Name | tert-butyl 4-ethyl-3,5-dimethyl-1H-pyrrole-2-carboxylate |
| SMILES | CCc1c(C)[nH]c(C(=O)OC(C)(C)C)c1C |
| InChI | InChI=1S/C13H21NO2/c1-7-10-8(2)11(14-9(10)3)12(15)16-13(4,5)6/h14H,7H2,1-6H3 |
| InChIKey | HSJFMXVYQCWHPK-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze tert-butyl 4-ethyl-3,5-dimethyl-1H-pyrrole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4-ethyl-3,5-dimethyl-1H-pyrrole-2-carboxylate?
The IUPAC name of tert-butyl 4-ethyl-3,5-dimethyl-1H-pyrrole-2-carboxylate (CID 2825670) is tert-butyl 4-ethyl-3,5-dimethyl-1H-pyrrole-2-carboxylate.
What is the SMILES notation for tert-butyl 4-ethyl-3,5-dimethyl-1H-pyrrole-2-carboxylate?
The canonical SMILES for tert-butyl 4-ethyl-3,5-dimethyl-1H-pyrrole-2-carboxylate is CCc1c(C)[nH]c(C(=O)OC(C)(C)C)c1C.
What is the InChIKey of tert-butyl 4-ethyl-3,5-dimethyl-1H-pyrrole-2-carboxylate?
The InChIKey is HSJFMXVYQCWHPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21NO2/c1-7-10-8(2)11(14-9(10)3)12(15)16-13(4,5)6/h14H,7H2,1-6H3.
What are the key properties of tert-butyl 4-ethyl-3,5-dimethyl-1H-pyrrole-2-carboxylate?
tert-butyl 4-ethyl-3,5-dimethyl-1H-pyrrole-2-carboxylate has a molecular weight of 223.32 g/mol, XLogP of 3.15, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-ethyl-3,5-dimethyl-1H-pyrrole-2-carboxylate is sourced from PubChem (CID 2825670), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).