C12H17NO3 — CID 86238468
ethyl 3,5-dimethyl-4-(3-oxopropyl)-1H-pyrrole-2-carboxylate (PubChem CID 86238468) has the molecular formula C12H17NO3 and a molecular weight of 223.27 g/mol. Its IUPAC name is ethyl 3,5-dimethyl-4-(3-oxopropyl)-1H-pyrrole-2-carboxylate.
| Compound Name | ethyl 3,5-dimethyl-4-(3-oxopropyl)-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 86238468 |
| Molecular Formula | C12H17NO3 |
| Molecular Weight | 223.27 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | ethyl 3,5-dimethyl-4-(3-oxopropyl)-1H-pyrrole-2-carboxylate |
| SMILES | CCOC(=O)c1[nH]c(C)c(CCC=O)c1C |
| InChI | InChI=1S/C12H17NO3/c1-4-16-12(15)11-8(2)10(6-5-7-14)9(3)13-11/h7,13H,4-6H2,1-3H3 |
| InChIKey | UWJFLMBXNTWLRI-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 59.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.27 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|