C16H21N2O2+ — CID 6942339
(5-ethoxycarbonyl-2,4-dimethyl-1H-pyrrol-3-yl)methyl-phenylazanium (PubChem CID 6942339) has the molecular formula C16H21N2O2+ and a molecular weight of 273.36 g/mol. Its IUPAC name is (5-ethoxycarbonyl-2,4-dimethyl-1H-pyrrol-3-yl)methyl-phenylazanium.
| Compound Name | (5-ethoxycarbonyl-2,4-dimethyl-1H-pyrrol-3-yl)methyl-phenylazanium |
|---|---|
| PubChem CID | 6942339 |
| Molecular Formula | C16H21N2O2+ |
| Molecular Weight | 273.36 g/mol |
| Exact Mass | 273.16 |
| IUPAC Name | (5-ethoxycarbonyl-2,4-dimethyl-1H-pyrrol-3-yl)methyl-phenylazanium |
| SMILES | CCOC(=O)c1[nH]c(C)c(C[NH2+]c2ccccc2)c1C |
| InChI | InChI=1S/C16H20N2O2/c1-4-20-16(19)15-11(2)14(12(3)18-15)10-17-13-8-6-5-7-9-13/h5-9,17-18H,4,10H2,1-3H3/p+1 |
| InChIKey | JDDQVGQVUSCASW-UHFFFAOYSA-O |
| XLogP | 2.20 |
| TPSA | 58.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.36 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|