C9H12NO2Tl — CID 10951554
(5-ethoxycarbonyl-2,4-dimethyl-1H-pyrrol-3-yl)thallium (PubChem CID 10951554) has the molecular formula C9H12NO2Tl and a molecular weight of 370.58 g/mol. Its IUPAC name is (5-ethoxycarbonyl-2,4-dimethyl-1H-pyrrol-3-yl)thallium.
| Compound Name | (5-ethoxycarbonyl-2,4-dimethyl-1H-pyrrol-3-yl)thallium |
|---|---|
| PubChem CID | 10951554 |
| Molecular Formula | C9H12NO2Tl |
| Molecular Weight | 370.58 g/mol |
| Exact Mass | 371.06 |
| IUPAC Name | (5-ethoxycarbonyl-2,4-dimethyl-1H-pyrrol-3-yl)thallium |
| SMILES | CCOC(=O)c1[nH]c(C)c([Tl])c1C |
| InChI | InChI=1S/C9H12NO2.Tl/c1-4-12-9(11)8-6(2)5-7(3)10-8;/h10H,4H2,1-3H3; |
| InChIKey | BRRWDUJBXIFBNU-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.58 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |