C9H12N3O2- — CID 134836459
(5-ethoxycarbonyl-2,4-dimethyl-1H-pyrrol-3-yl)iminoazanide (PubChem CID 134836459) has the molecular formula C9H12N3O2- and a molecular weight of 194.21 g/mol. Its IUPAC name is (5-ethoxycarbonyl-2,4-dimethyl-1H-pyrrol-3-yl)iminoazanide.
| Compound Name | (5-ethoxycarbonyl-2,4-dimethyl-1H-pyrrol-3-yl)iminoazanide |
|---|---|
| PubChem CID | 134836459 |
| Molecular Formula | C9H12N3O2- |
| Molecular Weight | 194.21 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | (5-ethoxycarbonyl-2,4-dimethyl-1H-pyrrol-3-yl)iminoazanide |
| SMILES | CCOC(=O)c1[nH]c(C)c(N=[N-])c1C |
| InChI | InChI=1S/C9H12N3O2/c1-4-14-9(13)8-5(2)7(12-10)6(3)11-8/h11H,4H2,1-3H3/q-1 |
| InChIKey | HJRLGTFELZOEEX-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 76.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.21 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|