About 3-(5-ethoxycarbonyl-2,4-dimethyl-1H-pyrrol-3-yl)-2,3-dihydroxypropanoic acid
3-(5-ethoxycarbonyl-2,4-dimethyl-1H-pyrrol-3-yl)-2,3-dihydroxypropanoic acid (PubChem CID 170824878) has the molecular formula C12H17NO6
and a molecular weight of 271.27 g/mol. Its IUPAC name is 3-(5-ethoxycarbonyl-2,4-dimethyl-1H-pyrrol-3-yl)-2,3-dihydroxypropanoic acid.
Molecular Properties
| Compound Name | 3-(5-ethoxycarbonyl-2,4-dimethyl-1H-pyrrol-3-yl)-2,3-dihydroxypropanoic acid |
| PubChem CID | 170824878 |
| Molecular Formula | C12H17NO6 |
| Molecular Weight | 271.27 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | 3-(5-ethoxycarbonyl-2,4-dimethyl-1H-pyrrol-3-yl)-2,3-dihydroxypropanoic acid |
| SMILES | CCOC(=O)c1[nH]c(C)c(C(O)C(O)C(=O)O)c1C |
| InChI | InChI=1S/C12H17NO6/c1-4-19-12(18)8-5(2)7(6(3)13-8)9(14)10(15)11(16)17/h9-10,13-15H,4H2,1-3H3,(H,16,17) |
| InChIKey | HWJVSCZNYAXDRD-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 119.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.27 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(5-ethoxycarbonyl-2,4-dimethyl-1H-pyrrol-3-yl)-2,3-dihydroxypropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(5-ethoxycarbonyl-2,4-dimethyl-1H-pyrrol-3-yl)-2,3-dihydroxypropanoic acid?
The IUPAC name of 3-(5-ethoxycarbonyl-2,4-dimethyl-1H-pyrrol-3-yl)-2,3-dihydroxypropanoic acid (CID 170824878) is 3-(5-ethoxycarbonyl-2,4-dimethyl-1H-pyrrol-3-yl)-2,3-dihydroxypropanoic acid.
What is the SMILES notation for 3-(5-ethoxycarbonyl-2,4-dimethyl-1H-pyrrol-3-yl)-2,3-dihydroxypropanoic acid?
The canonical SMILES for 3-(5-ethoxycarbonyl-2,4-dimethyl-1H-pyrrol-3-yl)-2,3-dihydroxypropanoic acid is CCOC(=O)c1[nH]c(C)c(C(O)C(O)C(=O)O)c1C.
What is the InChIKey of 3-(5-ethoxycarbonyl-2,4-dimethyl-1H-pyrrol-3-yl)-2,3-dihydroxypropanoic acid?
The InChIKey is HWJVSCZNYAXDRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO6/c1-4-19-12(18)8-5(2)7(6(3)13-8)9(14)10(15)11(16)17/h9-10,13-15H,4H2,1-3H3,(H,16,17).
What are the key properties of 3-(5-ethoxycarbonyl-2,4-dimethyl-1H-pyrrol-3-yl)-2,3-dihydroxypropanoic acid?
3-(5-ethoxycarbonyl-2,4-dimethyl-1H-pyrrol-3-yl)-2,3-dihydroxypropanoic acid has a molecular weight of 271.27 g/mol, XLogP of 0.29, 5 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5-ethoxycarbonyl-2,4-dimethyl-1H-pyrrol-3-yl)-2,3-dihydroxypropanoic acid is sourced from PubChem (CID 170824878), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).