C13H16N2O3 — CID 170473946
ethyl 4-(4-amino-4-oxobut-1-ynyl)-3,5-dimethyl-1H-pyrrole-2-carboxylate (PubChem CID 170473946) has the molecular formula C13H16N2O3 and a molecular weight of 248.28 g/mol. Its IUPAC name is ethyl 4-(4-amino-4-oxobut-1-ynyl)-3,5-dimethyl-1H-pyrrole-2-carboxylate.
| Compound Name | ethyl 4-(4-amino-4-oxobut-1-ynyl)-3,5-dimethyl-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 170473946 |
| Molecular Formula | C13H16N2O3 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | ethyl 4-(4-amino-4-oxobut-1-ynyl)-3,5-dimethyl-1H-pyrrole-2-carboxylate |
| SMILES | CCOC(=O)c1[nH]c(C)c(C#CCC(N)=O)c1C |
| InChI | InChI=1S/C13H16N2O3/c1-4-18-13(17)12-8(2)10(9(3)15-12)6-5-7-11(14)16/h15H,4,7H2,1-3H3,(H2,14,16) |
| InChIKey | UDHITURABCWOGH-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 85.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|