C11H13Cl2NO3 — CID 44718303
ethyl 4-acetyl-5-(dichloromethyl)-3-methyl-1H-pyrrole-2-carboxylate (PubChem CID 44718303) has the molecular formula C11H13Cl2NO3 and a molecular weight of 278.14 g/mol. Its IUPAC name is ethyl 4-acetyl-5-(dichloromethyl)-3-methyl-1H-pyrrole-2-carboxylate.
| Compound Name | ethyl 4-acetyl-5-(dichloromethyl)-3-methyl-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 44718303 |
| Molecular Formula | C11H13Cl2NO3 |
| Molecular Weight | 278.14 g/mol |
| Exact Mass | 277.03 |
| IUPAC Name | ethyl 4-acetyl-5-(dichloromethyl)-3-methyl-1H-pyrrole-2-carboxylate |
| SMILES | CCOC(=O)c1[nH]c(C(Cl)Cl)c(C(C)=O)c1C |
| InChI | InChI=1S/C11H13Cl2NO3/c1-4-17-11(16)8-5(2)7(6(3)15)9(14-8)10(12)13/h10,14H,4H2,1-3H3 |
| InChIKey | DVFBCKRJCVSVFR-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 59.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.14 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|