C15H26NO5P — CID 177083245
tert-butyl 4-diethoxyphosphoryl-3,5-dimethyl-1H-pyrrole-2-carboxylate (PubChem CID 177083245) has the molecular formula C15H26NO5P and a molecular weight of 331.35 g/mol. Its IUPAC name is tert-butyl 4-diethoxyphosphoryl-3,5-dimethyl-1H-pyrrole-2-carboxylate.
| Compound Name | tert-butyl 4-diethoxyphosphoryl-3,5-dimethyl-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 177083245 |
| Molecular Formula | C15H26NO5P |
| Molecular Weight | 331.35 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | tert-butyl 4-diethoxyphosphoryl-3,5-dimethyl-1H-pyrrole-2-carboxylate |
| SMILES | CCOP(=O)(OCC)c1c(C)[nH]c(C(=O)OC(C)(C)C)c1C |
| InChI | InChI=1S/C15H26NO5P/c1-8-19-22(18,20-9-2)13-10(3)12(16-11(13)4)14(17)21-15(5,6)7/h16H,8-9H2,1-7H3 |
| InChIKey | HDNDCGGMWBRTSY-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 77.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.35 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|