C9H12NO2- — CID 53249439
4-ethyl-2,5-dimethyl-1H-pyrrole-3-carboxylate (PubChem CID 53249439) has the molecular formula C9H12NO2- and a molecular weight of 166.20 g/mol. Its IUPAC name is 4-ethyl-2,5-dimethyl-1H-pyrrole-3-carboxylate.
| Compound Name | 4-ethyl-2,5-dimethyl-1H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 53249439 |
| Molecular Formula | C9H12NO2- |
| Molecular Weight | 166.20 g/mol |
| Exact Mass | 166.09 |
| IUPAC Name | 4-ethyl-2,5-dimethyl-1H-pyrrole-3-carboxylate |
| SMILES | CCc1c(C)[nH]c(C)c1C(=O)[O-] |
| InChI | InChI=1S/C9H13NO2/c1-4-7-5(2)10-6(3)8(7)9(11)12/h10H,4H2,1-3H3,(H,11,12)/p-1 |
| InChIKey | DNTPONIOPDYFEK-UHFFFAOYSA-M |
| XLogP | 0.56 |
| TPSA | 55.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.20 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |