C11H11NO4-2 — CID 172987071
4,5-diethylpyridine-2,3-dicarboxylate (PubChem CID 172987071) has the molecular formula C11H11NO4-2 and a molecular weight of 221.21 g/mol. Its IUPAC name is 4,5-diethylpyridine-2,3-dicarboxylate.
| Compound Name | 4,5-diethylpyridine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 172987071 |
| Molecular Formula | C11H11NO4-2 |
| Molecular Weight | 221.21 g/mol |
| Exact Mass | 221.07 |
| IUPAC Name | 4,5-diethylpyridine-2,3-dicarboxylate |
| SMILES | CCc1cnc(C(=O)[O-])c(C(=O)[O-])c1CC |
| InChI | InChI=1S/C11H13NO4/c1-3-6-5-12-9(11(15)16)8(10(13)14)7(6)4-2/h5H,3-4H2,1-2H3,(H,13,14)(H,15,16)/p-2 |
| InChIKey | BAGHGSOKOFAVBL-UHFFFAOYSA-L |
| XLogP | -1.07 |
| TPSA | 93.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.21 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |