About 4,5-diethylpyridine-2,3-dicarboxylate
4,5-diethylpyridine-2,3-dicarboxylate (PubChem CID 172987071) has the molecular formula C11H11NO4-2
and a molecular weight of 221.21 g/mol. Its IUPAC name is 4,5-diethylpyridine-2,3-dicarboxylate.
Molecular Properties
| Compound Name | 4,5-diethylpyridine-2,3-dicarboxylate |
| PubChem CID | 172987071 |
| Molecular Formula | C11H11NO4-2 |
| Molecular Weight | 221.21 g/mol |
| Exact Mass | 221.07 |
| IUPAC Name | 4,5-diethylpyridine-2,3-dicarboxylate |
| SMILES | CCc1cnc(C(=O)[O-])c(C(=O)[O-])c1CC |
| InChI | InChI=1S/C11H13NO4/c1-3-6-5-12-9(11(15)16)8(10(13)14)7(6)4-2/h5H,3-4H2,1-2H3,(H,13,14)(H,15,16)/p-2 |
| InChIKey | BAGHGSOKOFAVBL-UHFFFAOYSA-L |
| XLogP | -1.07 |
| TPSA | 93.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.21 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4,5-diethylpyridine-2,3-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-diethylpyridine-2,3-dicarboxylate?
The IUPAC name of 4,5-diethylpyridine-2,3-dicarboxylate (CID 172987071) is 4,5-diethylpyridine-2,3-dicarboxylate.
What is the SMILES notation for 4,5-diethylpyridine-2,3-dicarboxylate?
The canonical SMILES for 4,5-diethylpyridine-2,3-dicarboxylate is CCc1cnc(C(=O)[O-])c(C(=O)[O-])c1CC.
What is the InChIKey of 4,5-diethylpyridine-2,3-dicarboxylate?
The InChIKey is BAGHGSOKOFAVBL-UHFFFAOYSA-L. The full InChI is InChI=1S/C11H13NO4/c1-3-6-5-12-9(11(15)16)8(10(13)14)7(6)4-2/h5H,3-4H2,1-2H3,(H,13,14)(H,15,16)/p-2.
What are the key properties of 4,5-diethylpyridine-2,3-dicarboxylate?
4,5-diethylpyridine-2,3-dicarboxylate has a molecular weight of 221.21 g/mol, XLogP of -1.07, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-diethylpyridine-2,3-dicarboxylate is sourced from PubChem (CID 172987071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).