About 2-(4-ethyl-3,5-dimethyl-1H-pyrrol-2-yl)acetamide
2-(4-ethyl-3,5-dimethyl-1H-pyrrol-2-yl)acetamide (PubChem CID 118683549) has the molecular formula C10H16N2O
and a molecular weight of 180.25 g/mol. Its IUPAC name is 2-(4-ethyl-3,5-dimethyl-1H-pyrrol-2-yl)acetamide.
Molecular Properties
| Compound Name | 2-(4-ethyl-3,5-dimethyl-1H-pyrrol-2-yl)acetamide |
| PubChem CID | 118683549 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | 2-(4-ethyl-3,5-dimethyl-1H-pyrrol-2-yl)acetamide |
| SMILES | CCc1c(C)[nH]c(CC(N)=O)c1C |
| InChI | InChI=1S/C10H16N2O/c1-4-8-6(2)9(5-10(11)13)12-7(8)3/h12H,4-5H2,1-3H3,(H2,11,13) |
| InChIKey | WOQFKOGZJIBEFH-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 58.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(4-ethyl-3,5-dimethyl-1H-pyrrol-2-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-ethyl-3,5-dimethyl-1H-pyrrol-2-yl)acetamide?
The IUPAC name of 2-(4-ethyl-3,5-dimethyl-1H-pyrrol-2-yl)acetamide (CID 118683549) is 2-(4-ethyl-3,5-dimethyl-1H-pyrrol-2-yl)acetamide.
What is the SMILES notation for 2-(4-ethyl-3,5-dimethyl-1H-pyrrol-2-yl)acetamide?
The canonical SMILES for 2-(4-ethyl-3,5-dimethyl-1H-pyrrol-2-yl)acetamide is CCc1c(C)[nH]c(CC(N)=O)c1C.
What is the InChIKey of 2-(4-ethyl-3,5-dimethyl-1H-pyrrol-2-yl)acetamide?
The InChIKey is WOQFKOGZJIBEFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2O/c1-4-8-6(2)9(5-10(11)13)12-7(8)3/h12H,4-5H2,1-3H3,(H2,11,13).
What are the key properties of 2-(4-ethyl-3,5-dimethyl-1H-pyrrol-2-yl)acetamide?
2-(4-ethyl-3,5-dimethyl-1H-pyrrol-2-yl)acetamide has a molecular weight of 180.25 g/mol, XLogP of 1.22, 3 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-ethyl-3,5-dimethyl-1H-pyrrol-2-yl)acetamide is sourced from PubChem (CID 118683549), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).