C10H16N2O — CID 118683549
2-(4-ethyl-3,5-dimethyl-1H-pyrrol-2-yl)acetamide (PubChem CID 118683549) has the molecular formula C10H16N2O and a molecular weight of 180.25 g/mol. Its IUPAC name is 2-(4-ethyl-3,5-dimethyl-1H-pyrrol-2-yl)acetamide.
| Compound Name | 2-(4-ethyl-3,5-dimethyl-1H-pyrrol-2-yl)acetamide |
|---|---|
| PubChem CID | 118683549 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | 2-(4-ethyl-3,5-dimethyl-1H-pyrrol-2-yl)acetamide |
| SMILES | CCc1c(C)[nH]c(CC(N)=O)c1C |
| InChI | InChI=1S/C10H16N2O/c1-4-8-6(2)9(5-10(11)13)12-7(8)3/h12H,4-5H2,1-3H3,(H2,11,13) |
| InChIKey | WOQFKOGZJIBEFH-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 58.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |