C13H22NP — CID 142461641
2,4,6-triethyl-3-methyl-5-phosphanylaniline (PubChem CID 142461641) has the molecular formula C13H22NP and a molecular weight of 223.30 g/mol. Its IUPAC name is 2,4,6-triethyl-3-methyl-5-phosphanylaniline.
| Compound Name | 2,4,6-triethyl-3-methyl-5-phosphanylaniline |
|---|---|
| PubChem CID | 142461641 |
| Molecular Formula | C13H22NP |
| Molecular Weight | 223.30 g/mol |
| Exact Mass | 223.15 |
| IUPAC Name | 2,4,6-triethyl-3-methyl-5-phosphanylaniline |
| SMILES | CCc1c(C)c(CC)c(P)c(CC)c1N |
| InChI | InChI=1S/C13H22NP/c1-5-9-8(4)10(6-2)13(15)11(7-3)12(9)14/h5-7,14-15H2,1-4H3 |
| InChIKey | VQQWHFUZSLHRGQ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.30 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|