C8H14N3P — CID 163738273
5,6-dimethyl-3-phosphanylbenzene-1,2,4-triamine (PubChem CID 163738273) has the molecular formula C8H14N3P and a molecular weight of 183.19 g/mol. Its IUPAC name is 5,6-dimethyl-3-phosphanylbenzene-1,2,4-triamine.
| Compound Name | 5,6-dimethyl-3-phosphanylbenzene-1,2,4-triamine |
|---|---|
| PubChem CID | 163738273 |
| Molecular Formula | C8H14N3P |
| Molecular Weight | 183.19 g/mol |
| Exact Mass | 183.09 |
| IUPAC Name | 5,6-dimethyl-3-phosphanylbenzene-1,2,4-triamine |
| SMILES | Cc1c(C)c(N)c(P)c(N)c1N |
| InChI | InChI=1S/C8H14N3P/c1-3-4(2)6(10)8(12)7(11)5(3)9/h9-12H2,1-2H3 |
| InChIKey | LFNXTJBITUNORJ-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 78.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.19 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|