C11H16IN — CID 134361055
4-(iodomethyl)-2,3,5,6-tetramethylaniline (PubChem CID 134361055) has the molecular formula C11H16IN and a molecular weight of 289.16 g/mol. Its IUPAC name is 4-(iodomethyl)-2,3,5,6-tetramethylaniline.
| Compound Name | 4-(iodomethyl)-2,3,5,6-tetramethylaniline |
|---|---|
| PubChem CID | 134361055 |
| Molecular Formula | C11H16IN |
| Molecular Weight | 289.16 g/mol |
| Exact Mass | 289.03 |
| IUPAC Name | 4-(iodomethyl)-2,3,5,6-tetramethylaniline |
| SMILES | Cc1c(C)c(CI)c(C)c(C)c1N |
| InChI | InChI=1S/C11H16IN/c1-6-8(3)11(13)9(4)7(2)10(6)5-12/h5,13H2,1-4H3 |
| InChIKey | IUJBWBNSMRQZTG-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.16 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|