C7H11N3O2 — CID 163832497
2,3,5-triamino-6-methylbenzene-1,4-diol (PubChem CID 163832497) has the molecular formula C7H11N3O2 and a molecular weight of 169.18 g/mol. Its IUPAC name is 2,3,5-triamino-6-methylbenzene-1,4-diol.
| Compound Name | 2,3,5-triamino-6-methylbenzene-1,4-diol |
|---|---|
| PubChem CID | 163832497 |
| Molecular Formula | C7H11N3O2 |
| Molecular Weight | 169.18 g/mol |
| Exact Mass | 169.09 |
| IUPAC Name | 2,3,5-triamino-6-methylbenzene-1,4-diol |
| SMILES | Cc1c(N)c(O)c(N)c(N)c1O |
| InChI | InChI=1S/C7H11N3O2/c1-2-3(8)7(12)5(10)4(9)6(2)11/h11-12H,8-10H2,1H3 |
| InChIKey | OEVWVYDEPIVZJY-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 118.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.18 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|