C19H25NO3 — CID 90747803
2-amino-4-(3-hydroxy-4-methoxy-2,5,6-trimethylphenyl)-3,5,6-trimethylphenol (PubChem CID 90747803) has the molecular formula C19H25NO3 and a molecular weight of 315.41 g/mol. Its IUPAC name is 2-amino-4-(3-hydroxy-4-methoxy-2,5,6-trimethylphenyl)-3,5,6-trimethylphenol.
| Compound Name | 2-amino-4-(3-hydroxy-4-methoxy-2,5,6-trimethylphenyl)-3,5,6-trimethylphenol |
|---|---|
| PubChem CID | 90747803 |
| Molecular Formula | C19H25NO3 |
| Molecular Weight | 315.41 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | 2-amino-4-(3-hydroxy-4-methoxy-2,5,6-trimethylphenyl)-3,5,6-trimethylphenol |
| SMILES | COc1c(C)c(C)c(-c2c(C)c(C)c(O)c(N)c2C)c(C)c1O |
| InChI | InChI=1S/C19H25NO3/c1-8-10(3)17(21)16(20)12(5)14(8)15-9(2)11(4)19(23-7)18(22)13(15)6/h21-22H,20H2,1-7H3 |
| InChIKey | RLBMKAUVQPATNS-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.41 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|