C9H12ClNO2 — CID 84670347
2-amino-3-chloro-5-methoxy-4,6-dimethylphenol (PubChem CID 84670347) has the molecular formula C9H12ClNO2 and a molecular weight of 201.65 g/mol. Its IUPAC name is 2-amino-3-chloro-5-methoxy-4,6-dimethylphenol.
| Compound Name | 2-amino-3-chloro-5-methoxy-4,6-dimethylphenol |
|---|---|
| PubChem CID | 84670347 |
| Molecular Formula | C9H12ClNO2 |
| Molecular Weight | 201.65 g/mol |
| Exact Mass | 201.06 |
| IUPAC Name | 2-amino-3-chloro-5-methoxy-4,6-dimethylphenol |
| SMILES | COc1c(C)c(O)c(N)c(Cl)c1C |
| InChI | InChI=1S/C9H12ClNO2/c1-4-6(10)7(11)8(12)5(2)9(4)13-3/h12H,11H2,1-3H3 |
| InChIKey | CCLIJGKIKFDTHN-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.65 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|