C11H16ClNO3 — CID 117366782
4-chloro-2-methoxy-6-[(methoxyamino)methyl]-3,5-dimethylphenol (PubChem CID 117366782) has the molecular formula C11H16ClNO3 and a molecular weight of 245.71 g/mol. Its IUPAC name is 4-chloro-2-methoxy-6-[(methoxyamino)methyl]-3,5-dimethylphenol.
| Compound Name | 4-chloro-2-methoxy-6-[(methoxyamino)methyl]-3,5-dimethylphenol |
|---|---|
| PubChem CID | 117366782 |
| Molecular Formula | C11H16ClNO3 |
| Molecular Weight | 245.71 g/mol |
| Exact Mass | 245.08 |
| IUPAC Name | 4-chloro-2-methoxy-6-[(methoxyamino)methyl]-3,5-dimethylphenol |
| SMILES | CONCc1c(C)c(Cl)c(C)c(OC)c1O |
| InChI | InChI=1S/C11H16ClNO3/c1-6-8(5-13-16-4)10(14)11(15-3)7(2)9(6)12/h13-14H,5H2,1-4H3 |
| InChIKey | CAEFFACEWHJMAT-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.71 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|