C10H14ClNO — CID 10655623
2-chloro-5-methoxy-3,4,6-trimethylaniline (PubChem CID 10655623) has the molecular formula C10H14ClNO and a molecular weight of 199.68 g/mol. Its IUPAC name is 2-chloro-5-methoxy-3,4,6-trimethylaniline.
| Compound Name | 2-chloro-5-methoxy-3,4,6-trimethylaniline |
|---|---|
| PubChem CID | 10655623 |
| Molecular Formula | C10H14ClNO |
| Molecular Weight | 199.68 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | 2-chloro-5-methoxy-3,4,6-trimethylaniline |
| SMILES | COc1c(C)c(C)c(Cl)c(N)c1C |
| InChI | InChI=1S/C10H14ClNO/c1-5-6(2)10(13-4)7(3)9(12)8(5)11/h12H2,1-4H3 |
| InChIKey | UIFMCMRPROCBOE-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.68 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|