C10H11ClF3NO — CID 54008381
3-chloro-2,4,5-trimethyl-6-(trifluoromethoxy)aniline (PubChem CID 54008381) has the molecular formula C10H11ClF3NO and a molecular weight of 253.65 g/mol. Its IUPAC name is 3-chloro-2,4,5-trimethyl-6-(trifluoromethoxy)aniline.
| Compound Name | 3-chloro-2,4,5-trimethyl-6-(trifluoromethoxy)aniline |
|---|---|
| PubChem CID | 54008381 |
| Molecular Formula | C10H11ClF3NO |
| Molecular Weight | 253.65 g/mol |
| Exact Mass | 253.05 |
| IUPAC Name | 3-chloro-2,4,5-trimethyl-6-(trifluoromethoxy)aniline |
| SMILES | Cc1c(C)c(OC(F)(F)F)c(N)c(C)c1Cl |
| InChI | InChI=1S/C10H11ClF3NO/c1-4-5(2)9(16-10(12,13)14)8(15)6(3)7(4)11/h15H2,1-3H3 |
| InChIKey | KQNIUXPEOCDGIY-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.65 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|