C12H15F3O — CID 118068021
1,2,3,4,5-pentamethyl-6-(trifluoromethoxy)benzene (PubChem CID 118068021) has the molecular formula C12H15F3O and a molecular weight of 232.24 g/mol. Its IUPAC name is 1,2,3,4,5-pentamethyl-6-(trifluoromethoxy)benzene.
| Compound Name | 1,2,3,4,5-pentamethyl-6-(trifluoromethoxy)benzene |
|---|---|
| PubChem CID | 118068021 |
| Molecular Formula | C12H15F3O |
| Molecular Weight | 232.24 g/mol |
| Exact Mass | 232.11 |
| IUPAC Name | 1,2,3,4,5-pentamethyl-6-(trifluoromethoxy)benzene |
| SMILES | Cc1c(C)c(C)c(OC(F)(F)F)c(C)c1C |
| InChI | InChI=1S/C12H15F3O/c1-6-7(2)9(4)11(10(5)8(6)3)16-12(13,14)15/h1-5H3 |
| InChIKey | RWZXUHWDXXWTHX-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.24 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |