C10H8F6O2 — CID 59592266
1,5-dimethyl-2,3-bis(trifluoromethoxy)benzene (PubChem CID 59592266) has the molecular formula C10H8F6O2 and a molecular weight of 274.16 g/mol. Its IUPAC name is 1,5-dimethyl-2,3-bis(trifluoromethoxy)benzene.
| Compound Name | 1,5-dimethyl-2,3-bis(trifluoromethoxy)benzene |
|---|---|
| PubChem CID | 59592266 |
| Molecular Formula | C10H8F6O2 |
| Molecular Weight | 274.16 g/mol |
| Exact Mass | 274.04 |
| IUPAC Name | 1,5-dimethyl-2,3-bis(trifluoromethoxy)benzene |
| SMILES | Cc1cc(C)c(OC(F)(F)F)c(OC(F)(F)F)c1 |
| InChI | InChI=1S/C10H8F6O2/c1-5-3-6(2)8(18-10(14,15)16)7(4-5)17-9(11,12)13/h3-4H,1-2H3 |
| InChIKey | VIMKRLKJGSKNKF-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.16 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |