C15H13F3OS — CID 177164257
4-[3,5-dimethyl-4-(trifluoromethoxy)phenyl]benzenethiol (PubChem CID 177164257) has the molecular formula C15H13F3OS and a molecular weight of 298.33 g/mol. Its IUPAC name is 4-[3,5-dimethyl-4-(trifluoromethoxy)phenyl]benzenethiol.
| Compound Name | 4-[3,5-dimethyl-4-(trifluoromethoxy)phenyl]benzenethiol |
|---|---|
| PubChem CID | 177164257 |
| Molecular Formula | C15H13F3OS |
| Molecular Weight | 298.33 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | 4-[3,5-dimethyl-4-(trifluoromethoxy)phenyl]benzenethiol |
| SMILES | Cc1cc(-c2ccc(S)cc2)cc(C)c1OC(F)(F)F |
| InChI | InChI=1S/C15H13F3OS/c1-9-7-12(11-3-5-13(20)6-4-11)8-10(2)14(9)19-15(16,17)18/h3-8,20H,1-2H3 |
| InChIKey | VYEOALIQFGVBJA-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.33 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|