C14H12F2S — CID 142872005
4-[3-(1,1-difluoroethyl)phenyl]benzenethiol (PubChem CID 142872005) has the molecular formula C14H12F2S and a molecular weight of 250.31 g/mol. Its IUPAC name is 4-[3-(1,1-difluoroethyl)phenyl]benzenethiol.
| Compound Name | 4-[3-(1,1-difluoroethyl)phenyl]benzenethiol |
|---|---|
| PubChem CID | 142872005 |
| Molecular Formula | C14H12F2S |
| Molecular Weight | 250.31 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | 4-[3-(1,1-difluoroethyl)phenyl]benzenethiol |
| SMILES | CC(F)(F)c1cccc(-c2ccc(S)cc2)c1 |
| InChI | InChI=1S/C14H12F2S/c1-14(15,16)12-4-2-3-11(9-12)10-5-7-13(17)8-6-10/h2-9,17H,1H3 |
| InChIKey | ZLVAVCMWYYCJQO-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.31 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|