C14H16N2 — CID 174427406
1-(3-phenylphenyl)ethane-1,1-diamine (PubChem CID 174427406) has the molecular formula C14H16N2 and a molecular weight of 212.30 g/mol. Its IUPAC name is 1-(3-phenylphenyl)ethane-1,1-diamine.
| Compound Name | 1-(3-phenylphenyl)ethane-1,1-diamine |
|---|---|
| PubChem CID | 174427406 |
| Molecular Formula | C14H16N2 |
| Molecular Weight | 212.30 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | 1-(3-phenylphenyl)ethane-1,1-diamine |
| SMILES | CC(N)(N)c1cccc(-c2ccccc2)c1 |
| InChI | InChI=1S/C14H16N2/c1-14(15,16)13-9-5-8-12(10-13)11-6-3-2-4-7-11/h2-10H,15-16H2,1H3 |
| InChIKey | UUCPNYVWNVPFIR-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.30 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|