C20H13F11O — CID 162347175
1-(3-phenylphenyl)-1-(1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexyl)ethanol (PubChem CID 162347175) has the molecular formula C20H13F11O and a molecular weight of 478.30 g/mol. Its IUPAC name is 1-(3-phenylphenyl)-1-(1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexyl)ethanol.
| Compound Name | 1-(3-phenylphenyl)-1-(1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexyl)ethanol |
|---|---|
| PubChem CID | 162347175 |
| Molecular Formula | C20H13F11O |
| Molecular Weight | 478.30 g/mol |
| Exact Mass | 478.08 |
| IUPAC Name | 1-(3-phenylphenyl)-1-(1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexyl)ethanol |
| SMILES | CC(O)(c1cccc(-c2ccccc2)c1)C1(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C20H13F11O/c1-14(32,13-9-5-8-12(10-13)11-6-3-2-4-7-11)15(21)16(22,23)18(26,27)20(30,31)19(28,29)17(15,24)25/h2-10,32H,1H3 |
| InChIKey | ODCKJSSQJOPHIF-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.30 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|