C26H29F — CID 168802983
1-tert-butyl-3-[3-(3-tert-butylphenyl)phenyl]-5-fluorobenzene (PubChem CID 168802983) has the molecular formula C26H29F and a molecular weight of 360.52 g/mol. Its IUPAC name is 1-tert-butyl-3-[3-(3-tert-butylphenyl)phenyl]-5-fluorobenzene.
| Compound Name | 1-tert-butyl-3-[3-(3-tert-butylphenyl)phenyl]-5-fluorobenzene |
|---|---|
| PubChem CID | 168802983 |
| Molecular Formula | C26H29F |
| Molecular Weight | 360.52 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | 1-tert-butyl-3-[3-(3-tert-butylphenyl)phenyl]-5-fluorobenzene |
| SMILES | CC(C)(C)c1cccc(-c2cccc(-c3cc(F)cc(C(C)(C)C)c3)c2)c1 |
| InChI | InChI=1S/C26H29F/c1-25(2,3)22-12-8-11-20(14-22)18-9-7-10-19(13-18)21-15-23(26(4,5)6)17-24(27)16-21/h7-17H,1-6H3 |
| InChIKey | USCBFPPUVHOSFY-UHFFFAOYSA-N |
| XLogP | 7.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.52 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |