C27H36N12 — CID 163411444
5-[3,5-bis(2,3,4,5-tetraamino-6-methylphenyl)phenyl]-6-methylbenzene-1,2,3,4-tetramine (PubChem CID 163411444) has the molecular formula C27H36N12 and a molecular weight of 528.67 g/mol. Its IUPAC name is 5-[3,5-bis(2,3,4,5-tetraamino-6-methylphenyl)phenyl]-6-methylbenzene-1,2,3,4-tetramine.
| Compound Name | 5-[3,5-bis(2,3,4,5-tetraamino-6-methylphenyl)phenyl]-6-methylbenzene-1,2,3,4-tetramine |
|---|---|
| PubChem CID | 163411444 |
| Molecular Formula | C27H36N12 |
| Molecular Weight | 528.67 g/mol |
| Exact Mass | 528.32 |
| IUPAC Name | 5-[3,5-bis(2,3,4,5-tetraamino-6-methylphenyl)phenyl]-6-methylbenzene-1,2,3,4-tetramine |
| SMILES | Cc1c(N)c(N)c(N)c(N)c1-c1cc(-c2c(C)c(N)c(N)c(N)c2N)cc(-c2c(C)c(N)c(N)c(N)c2N)c1 |
| InChI | InChI=1S/C27H36N12/c1-7-13(19(31)25(37)22(34)16(7)28)10-4-11(14-8(2)17(29)23(35)26(38)20(14)32)6-12(5-10)15-9(3)18(30)24(36)27(39)21(15)33/h4-6H,28-39H2,1-3H3 |
| InChIKey | AAVILGNJLLNMPD-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 312.24 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.67 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|