C10H15N — CID 20714339
3-ethyl-2,4-dimethylaniline (PubChem CID 20714339) has the molecular formula C10H15N and a molecular weight of 149.24 g/mol. Its IUPAC name is 3-ethyl-2,4-dimethylaniline.
| Compound Name | 3-ethyl-2,4-dimethylaniline |
|---|---|
| PubChem CID | 20714339 |
| Molecular Formula | C10H15N |
| Molecular Weight | 149.24 g/mol |
| Exact Mass | 149.12 |
| IUPAC Name | 3-ethyl-2,4-dimethylaniline |
| SMILES | CCc1c(C)ccc(N)c1C |
| InChI | InChI=1S/C10H15N/c1-4-9-7(2)5-6-10(11)8(9)3/h5-6H,4,11H2,1-3H3 |
| InChIKey | XTYWVGYXEANYDD-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.24 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|