C13H18 — CID 143363973
2-ethyl-1,3-dimethyl-4-prop-1-en-2-ylbenzene (PubChem CID 143363973) has the molecular formula C13H18 and a molecular weight of 174.29 g/mol. Its IUPAC name is 2-ethyl-1,3-dimethyl-4-prop-1-en-2-ylbenzene.
| Compound Name | 2-ethyl-1,3-dimethyl-4-prop-1-en-2-ylbenzene |
|---|---|
| PubChem CID | 143363973 |
| Molecular Formula | C13H18 |
| Molecular Weight | 174.29 g/mol |
| Exact Mass | 174.14 |
| IUPAC Name | 2-ethyl-1,3-dimethyl-4-prop-1-en-2-ylbenzene |
| SMILES | C=C(C)c1ccc(C)c(CC)c1C |
| InChI | InChI=1S/C13H18/c1-6-12-10(4)7-8-13(9(2)3)11(12)5/h7-8H,2,6H2,1,3-5H3 |
| InChIKey | JRMUPLQCBKBFSJ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.29 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |