About 1-(fluoromethyl)-2,3-dimethyl-4-prop-1-en-2-ylbenzene
1-(fluoromethyl)-2,3-dimethyl-4-prop-1-en-2-ylbenzene (PubChem CID 174185530) has the molecular formula C12H15F
and a molecular weight of 178.25 g/mol. Its IUPAC name is 1-(fluoromethyl)-2,3-dimethyl-4-prop-1-en-2-ylbenzene.
Analyze 1-(fluoromethyl)-2,3-dimethyl-4-prop-1-en-2-ylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(fluoromethyl)-2,3-dimethyl-4-prop-1-en-2-ylbenzene?
The IUPAC name of 1-(fluoromethyl)-2,3-dimethyl-4-prop-1-en-2-ylbenzene (CID 174185530) is 1-(fluoromethyl)-2,3-dimethyl-4-prop-1-en-2-ylbenzene.
What is the SMILES notation for 1-(fluoromethyl)-2,3-dimethyl-4-prop-1-en-2-ylbenzene?
The canonical SMILES for 1-(fluoromethyl)-2,3-dimethyl-4-prop-1-en-2-ylbenzene is C=C(C)c1ccc(CF)c(C)c1C.
What is the InChIKey of 1-(fluoromethyl)-2,3-dimethyl-4-prop-1-en-2-ylbenzene?
The InChIKey is UQBKMVSOECOTKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15F/c1-8(2)12-6-5-11(7-13)9(3)10(12)4/h5-6H,1,7H2,2-4H3.
What are the key properties of 1-(fluoromethyl)-2,3-dimethyl-4-prop-1-en-2-ylbenzene?
1-(fluoromethyl)-2,3-dimethyl-4-prop-1-en-2-ylbenzene has a molecular weight of 178.25 g/mol, XLogP of 3.81, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(fluoromethyl)-2,3-dimethyl-4-prop-1-en-2-ylbenzene is sourced from PubChem (CID 174185530), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).