C12H18N2O — CID 24711453
N-(3-amino-2,6-dimethylphenyl)butanamide (PubChem CID 24711453) has the molecular formula C12H18N2O and a molecular weight of 206.29 g/mol. Its IUPAC name is N-(3-amino-2,6-dimethylphenyl)butanamide.
| Compound Name | N-(3-amino-2,6-dimethylphenyl)butanamide |
|---|---|
| PubChem CID | 24711453 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | N-(3-amino-2,6-dimethylphenyl)butanamide |
| SMILES | CCCC(=O)Nc1c(C)ccc(N)c1C |
| InChI | InChI=1S/C12H18N2O/c1-4-5-11(15)14-12-8(2)6-7-10(13)9(12)3/h6-7H,4-5,13H2,1-3H3,(H,14,15) |
| InChIKey | KKOBIMFPCWZLBU-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|